C20H23F2N3O2S — CID 135192173
6-[[(2,3-difluoro-4-methylphenyl)methyl-hydroxyamino]sulfanylamino]-1-propyl-3,4-dihydroquinolin-2-one (PubChem CID 135192173) has the molecular formula C20H23F2N3O2S and a molecular weight of 407.49 g/mol. Its IUPAC name is 6-[[(2,3-difluoro-4-methylphenyl)methyl-hydroxyamino]sulfanylamino]-1-propyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[[(2,3-difluoro-4-methylphenyl)methyl-hydroxyamino]sulfanylamino]-1-propyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 135192173 |
| Molecular Formula | C20H23F2N3O2S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 6-[[(2,3-difluoro-4-methylphenyl)methyl-hydroxyamino]sulfanylamino]-1-propyl-3,4-dihydroquinolin-2-one |
| SMILES | CCCN1C(=O)CCc2cc(NSN(O)Cc3ccc(C)c(F)c3F)ccc21 |
| InChI | InChI=1S/C20H23F2N3O2S/c1-3-10-24-17-8-7-16(11-14(17)6-9-18(24)26)23-28-25(27)12-15-5-4-13(2)19(21)20(15)22/h4-5,7-8,11,23,27H,3,6,9-10,12H2,1-2H3 |
| InChIKey | CEAPMJPUVGZRQN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|