About 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole
2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole (PubChem CID 135195660) has the molecular formula C28H24N2
and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole.
Molecular Properties
| Compound Name | 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole |
| PubChem CID | 135195660 |
| Molecular Formula | C28H24N2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole |
| SMILES | Cc1c(-c2ccc3c(c2)[nH]c2c(C)ccc(C)c23)ccc2c1[nH]c1cccc(C)c12 |
| InChI | InChI=1S/C28H24N2/c1-15-6-5-7-23-25(15)22-13-12-20(18(4)28(22)29-23)19-10-11-21-24(14-19)30-27-17(3)9-8-16(2)26(21)27/h5-14,29-30H,1-4H3 |
| InChIKey | BFZPARWIWVWJQD-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole?
The IUPAC name of 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole (CID 135195660) is 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole.
What is the SMILES notation for 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole?
The canonical SMILES for 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole is Cc1c(-c2ccc3c(c2)[nH]c2c(C)ccc(C)c23)ccc2c1[nH]c1cccc(C)c12.
What is the InChIKey of 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole?
The InChIKey is BFZPARWIWVWJQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N2/c1-15-6-5-7-23-25(15)22-13-12-20(18(4)28(22)29-23)19-10-11-21-24(14-19)30-27-17(3)9-8-16(2)26(21)27/h5-14,29-30H,1-4H3.
What are the key properties of 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole?
2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole has a molecular weight of 388.51 g/mol, XLogP of 7.86, 1 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,8-dimethyl-9H-carbazol-2-yl)-1,5-dimethyl-9H-carbazole is sourced from PubChem (CID 135195660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).