C23H24FN5O — CID 135197485
12-[3-(6-fluoro-2H-indazol-3-yl)propyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 135197485) has the molecular formula C23H24FN5O and a molecular weight of 405.48 g/mol. Its IUPAC name is 12-[3-(6-fluoro-2H-indazol-3-yl)propyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | 12-[3-(6-fluoro-2H-indazol-3-yl)propyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 135197485 |
| Molecular Formula | C23H24FN5O |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 12-[3-(6-fluoro-2H-indazol-3-yl)propyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | O=C1CN2c3c(cccc3C3CN(CCCc4[nH]nc5cc(F)ccc45)CCC32)N1 |
| InChI | InChI=1S/C23H24FN5O/c24-14-6-7-16-18(26-27-20(16)11-14)5-2-9-28-10-8-21-17(12-28)15-3-1-4-19-23(15)29(21)13-22(30)25-19/h1,3-4,6-7,11,17,21H,2,5,8-10,12-13H2,(H,25,30)(H,26,27) |
| InChIKey | IYWYHDLOCSDKEQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |