C23H26FN3O2 — CID 160539773
(10R,15S)-12-[3-(2,3,6-trideuterio-4-fluoro-5-methylphenoxy)propyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 160539773) has the molecular formula C23H26FN3O2 and a molecular weight of 398.50 g/mol. Its IUPAC name is (10R,15S)-12-[3-(2,3,6-trideuterio-4-fluoro-5-methylphenoxy)propyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | (10R,15S)-12-[3-(2,3,6-trideuterio-4-fluoro-5-methylphenoxy)propyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 160539773 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (10R,15S)-12-[3-(2,3,6-trideuterio-4-fluoro-5-methylphenoxy)propyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | [2H]c1c([2H])c(OCCCN2CC[C@H]3[C@@H](C2)c2cccc4c2N3CC(=O)N4)c([2H])c(C)c1F |
| InChI | InChI=1S/C23H26FN3O2/c1-15-12-16(6-7-19(15)24)29-11-3-9-26-10-8-21-18(13-26)17-4-2-5-20-23(17)27(21)14-22(28)25-20/h2,4-7,12,18,21H,3,8-11,13-14H2,1H3,(H,25,28)/t18-,21-/m0/s1/i6D,7D,12D |
| InChIKey | SLJDWLVGULYNMO-GAJVBQEQSA-N |
| XLogP | 3.53 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|