C20H19F3N6O4 — CID 135200344
[[6-[[3-(2-pyrazol-1-ylethylcarbamoyl)phenyl]methoxy]pyrimidin-4-yl]methylamino] 2,2,2-trifluoroacetate (PubChem CID 135200344) has the molecular formula C20H19F3N6O4 and a molecular weight of 464.40 g/mol. Its IUPAC name is [[6-[[3-(2-pyrazol-1-ylethylcarbamoyl)phenyl]methoxy]pyrimidin-4-yl]methylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[6-[[3-(2-pyrazol-1-ylethylcarbamoyl)phenyl]methoxy]pyrimidin-4-yl]methylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 135200344 |
| Molecular Formula | C20H19F3N6O4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [[6-[[3-(2-pyrazol-1-ylethylcarbamoyl)phenyl]methoxy]pyrimidin-4-yl]methylamino] 2,2,2-trifluoroacetate |
| SMILES | O=C(NCCn1cccn1)c1cccc(COc2cc(CNOC(=O)C(F)(F)F)ncn2)c1 |
| InChI | InChI=1S/C20H19F3N6O4/c21-20(22,23)19(31)33-28-11-16-10-17(26-13-25-16)32-12-14-3-1-4-15(9-14)18(30)24-6-8-29-7-2-5-27-29/h1-5,7,9-10,13,28H,6,8,11-12H2,(H,24,30) |
| InChIKey | YCWJUYRPVCJTLJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|