C29H42N2O4 — CID 135200741
7-[(3E)-2,3-dimethoxy-3-(9-methyl-2,3,4,6,7,8-hexahydroquinolizin-1-ylidene)propyl]-6,8-dimethoxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene (PubChem CID 135200741) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is 7-[(3E)-2,3-dimethoxy-3-(9-methyl-2,3,4,6,7,8-hexahydroquinolizin-1-ylidene)propyl]-6,8-dimethoxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene.
| Compound Name | 7-[(3E)-2,3-dimethoxy-3-(9-methyl-2,3,4,6,7,8-hexahydroquinolizin-1-ylidene)propyl]-6,8-dimethoxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene |
|---|---|
| PubChem CID | 135200741 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 7-[(3E)-2,3-dimethoxy-3-(9-methyl-2,3,4,6,7,8-hexahydroquinolizin-1-ylidene)propyl]-6,8-dimethoxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene |
| SMILES | CO/C(=C1\CCCN2CCCC(C)=C12)C(Cc1c(OC)c2c3c(c1OC)CCCN3CCC2)OC |
| InChI | InChI=1S/C29H42N2O4/c1-19-10-6-14-30-15-7-11-20(25(19)30)29(35-5)24(32-2)18-23-27(33-3)21-12-8-16-31-17-9-13-22(26(21)31)28(23)34-4/h24H,6-18H2,1-5H3/b29-20+ |
| InChIKey | IRPZJDISPNGUGG-ZTKZIYFRSA-N |
| XLogP | 5.02 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|