C16H13ClN4O3S — CID 135201440
6-chloro-N-[5-(cyanomethyl)-3-methoxy-2-pyridinyl]-1H-indole-3-sulfonamide (PubChem CID 135201440) has the molecular formula C16H13ClN4O3S and a molecular weight of 376.83 g/mol. Its IUPAC name is 6-chloro-N-[5-(cyanomethyl)-3-methoxy-2-pyridinyl]-1H-indole-3-sulfonamide.
| Compound Name | 6-chloro-N-[5-(cyanomethyl)-3-methoxy-2-pyridinyl]-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 135201440 |
| Molecular Formula | C16H13ClN4O3S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 6-chloro-N-[5-(cyanomethyl)-3-methoxy-2-pyridinyl]-1H-indole-3-sulfonamide |
| SMILES | COc1cc(CC#N)cnc1NS(=O)(=O)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H13ClN4O3S/c1-24-14-6-10(4-5-18)8-20-16(14)21-25(22,23)15-9-19-13-7-11(17)2-3-12(13)15/h2-3,6-9,19H,4H2,1H3,(H,20,21) |
| InChIKey | YFDNWISNLYAACT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |