C23H21N3O3 — CID 135203447
8-(3,5-dimethyl-1,2-oxazol-4-yl)-7-prop-2-enoxy-1-(pyridin-2-ylmethyl)quinolin-2-one (PubChem CID 135203447) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 8-(3,5-dimethyl-1,2-oxazol-4-yl)-7-prop-2-enoxy-1-(pyridin-2-ylmethyl)quinolin-2-one.
| Compound Name | 8-(3,5-dimethyl-1,2-oxazol-4-yl)-7-prop-2-enoxy-1-(pyridin-2-ylmethyl)quinolin-2-one |
|---|---|
| PubChem CID | 135203447 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 8-(3,5-dimethyl-1,2-oxazol-4-yl)-7-prop-2-enoxy-1-(pyridin-2-ylmethyl)quinolin-2-one |
| SMILES | C=CCOc1ccc2ccc(=O)n(Cc3ccccn3)c2c1-c1c(C)noc1C |
| InChI | InChI=1S/C23H21N3O3/c1-4-13-28-19-10-8-17-9-11-20(27)26(14-18-7-5-6-12-24-18)23(17)22(19)21-15(2)25-29-16(21)3/h4-12H,1,13-14H2,2-3H3 |
| InChIKey | VWGWFLJBXZMYFO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|