C18H17N5O — CID 177247507
6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(pyridin-2-ylmethyl)benzimidazol-4-amine (PubChem CID 177247507) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(pyridin-2-ylmethyl)benzimidazol-4-amine.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(pyridin-2-ylmethyl)benzimidazol-4-amine |
|---|---|
| PubChem CID | 177247507 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(pyridin-2-ylmethyl)benzimidazol-4-amine |
| SMILES | Cc1noc(C)c1-c1cc(N)c2ncn(Cc3ccccn3)c2c1 |
| InChI | InChI=1S/C18H17N5O/c1-11-17(12(2)24-22-11)13-7-15(19)18-16(8-13)23(10-21-18)9-14-5-3-4-6-20-14/h3-8,10H,9,19H2,1-2H3 |
| InChIKey | YGJWKKRVJCVELI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|