C18H22N4O — CID 121375838
1-(cyclobutylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylbenzimidazol-4-amine (PubChem CID 121375838) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylbenzimidazol-4-amine.
| Compound Name | 1-(cyclobutylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylbenzimidazol-4-amine |
|---|---|
| PubChem CID | 121375838 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-(cyclobutylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylbenzimidazol-4-amine |
| SMILES | Cc1noc(C)c1-c1cc(N)c2nc(C)n(CC3CCC3)c2c1 |
| InChI | InChI=1S/C18H22N4O/c1-10-17(11(2)23-21-10)14-7-15(19)18-16(8-14)22(12(3)20-18)9-13-5-4-6-13/h7-8,13H,4-6,9,19H2,1-3H3 |
| InChIKey | BWPRGHMYAIXYSR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|