C19H29N3O2 — CID 142331207
4-[2-amino-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]cyclohexan-1-ol;ethane (PubChem CID 142331207) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-[2-amino-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]cyclohexan-1-ol;ethane.
| Compound Name | 4-[2-amino-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]cyclohexan-1-ol;ethane |
|---|---|
| PubChem CID | 142331207 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 4-[2-amino-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]cyclohexan-1-ol;ethane |
| SMILES | CC.Cc1noc(C)c1-c1ccc(NC2CCC(O)CC2)c(N)c1 |
| InChI | InChI=1S/C17H23N3O2.C2H6/c1-10-17(11(2)22-20-10)12-3-8-16(15(18)9-12)19-13-4-6-14(21)7-5-13;1-2/h3,8-9,13-14,19,21H,4-7,18H2,1-2H3;1-2H3 |
| InChIKey | RZNMGDZDGROURY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|