C20H28N4O3 — CID 153410652
butyl 3-[2-amino-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]pyrrolidine-1-carboxylate (PubChem CID 153410652) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is butyl 3-[2-amino-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]pyrrolidine-1-carboxylate.
| Compound Name | butyl 3-[2-amino-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 153410652 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | butyl 3-[2-amino-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(Nc2ccc(-c3c(C)noc3C)cc2N)C1 |
| InChI | InChI=1S/C20H28N4O3/c1-4-5-10-26-20(25)24-9-8-16(12-24)22-18-7-6-15(11-17(18)21)19-13(2)23-27-14(19)3/h6-7,11,16,22H,4-5,8-10,12,21H2,1-3H3 |
| InChIKey | KQKUQYMWRQEQED-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|