C16H19F2N3O — CID 153291200
1-N-(3,3-difluorocyclopentyl)-4-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine (PubChem CID 153291200) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 1-N-(3,3-difluorocyclopentyl)-4-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine.
| Compound Name | 1-N-(3,3-difluorocyclopentyl)-4-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 153291200 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-N-(3,3-difluorocyclopentyl)-4-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine |
| SMILES | Cc1noc(C)c1-c1ccc(NC2CCC(F)(F)C2)c(N)c1 |
| InChI | InChI=1S/C16H19F2N3O/c1-9-15(10(2)22-21-9)11-3-4-14(13(19)7-11)20-12-5-6-16(17,18)8-12/h3-4,7,12,20H,5-6,8,19H2,1-2H3 |
| InChIKey | SFKXNDBCDNUDQL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|