C12H11F3N2O2 — CID 156621301
5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(trifluoromethoxy)aniline (PubChem CID 156621301) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(trifluoromethoxy)aniline.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 156621301 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(trifluoromethoxy)aniline |
| SMILES | Cc1noc(C)c1-c1ccc(OC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C12H11F3N2O2/c1-6-11(7(2)19-17-6)8-3-4-10(9(16)5-8)18-12(13,14)15/h3-5H,16H2,1-2H3 |
| InChIKey | HUZMLLJACWCNOX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|