C16H22N4OS — CID 144744385
3-(cyclopentylamino)sulfanyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine (PubChem CID 144744385) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 3-(cyclopentylamino)sulfanyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine.
| Compound Name | 3-(cyclopentylamino)sulfanyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 144744385 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-(cyclopentylamino)sulfanyl-5-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine |
| SMILES | Cc1noc(C)c1-c1cc(N)c(N)c(SNC2CCCC2)c1 |
| InChI | InChI=1S/C16H22N4OS/c1-9-15(10(2)21-19-9)11-7-13(17)16(18)14(8-11)22-20-12-5-3-4-6-12/h7-8,12,20H,3-6,17-18H2,1-2H3 |
| InChIKey | LTAOKMFHKIETKM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|