C22H29N5O3S — CID 145336399
ethyl 3-[[4-(cyclopentylamino)sulfanyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-2-yl]amino]propanoate (PubChem CID 145336399) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is ethyl 3-[[4-(cyclopentylamino)sulfanyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-2-yl]amino]propanoate.
| Compound Name | ethyl 3-[[4-(cyclopentylamino)sulfanyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 145336399 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | ethyl 3-[[4-(cyclopentylamino)sulfanyl-6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-benzimidazol-2-yl]amino]propanoate |
| SMILES | CCOC(=O)CCNc1nc2c(SNC3CCCC3)cc(-c3c(C)noc3C)cc2[nH]1 |
| InChI | InChI=1S/C22H29N5O3S/c1-4-29-19(28)9-10-23-22-24-17-11-15(20-13(2)26-30-14(20)3)12-18(21(17)25-22)31-27-16-7-5-6-8-16/h11-12,16,27H,4-10H2,1-3H3,(H2,23,24,25) |
| InChIKey | OUKXMKUIKGWLMQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|