C13H17Cl2NS — CID 142297693
N-(2,5-dichloro-4-methylphenyl)sulfanylcyclohexanamine (PubChem CID 142297693) has the molecular formula C13H17Cl2NS and a molecular weight of 290.26 g/mol. Its IUPAC name is N-(2,5-dichloro-4-methylphenyl)sulfanylcyclohexanamine.
| Compound Name | N-(2,5-dichloro-4-methylphenyl)sulfanylcyclohexanamine |
|---|---|
| PubChem CID | 142297693 |
| Molecular Formula | C13H17Cl2NS |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-(2,5-dichloro-4-methylphenyl)sulfanylcyclohexanamine |
| SMILES | Cc1cc(Cl)c(SNC2CCCCC2)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NS/c1-9-7-12(15)13(8-11(9)14)17-16-10-5-3-2-4-6-10/h7-8,10,16H,2-6H2,1H3 |
| InChIKey | QYLABGUALCWNJJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|