C23H23N3O4S — CID 174779670
[8-carbamoyl-9-(cyclopropylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)carbazol-4-yl]methanesulfinic acid (PubChem CID 174779670) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is [8-carbamoyl-9-(cyclopropylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)carbazol-4-yl]methanesulfinic acid.
| Compound Name | [8-carbamoyl-9-(cyclopropylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)carbazol-4-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174779670 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [8-carbamoyl-9-(cyclopropylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)carbazol-4-yl]methanesulfinic acid |
| SMILES | Cc1noc(C)c1-c1cc(C(N)=O)c2c(c1)c1c(CS(=O)O)cccc1n2CC1CC1 |
| InChI | InChI=1S/C23H23N3O4S/c1-12-20(13(2)30-25-12)16-8-17-21-15(11-31(28)29)4-3-5-19(21)26(10-14-6-7-14)22(17)18(9-16)23(24)27/h3-5,8-9,14H,6-7,10-11H2,1-2H3,(H2,24,27)(H,28,29) |
| InChIKey | JZTFUTJMKDXPDT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|