C22H23IN5O3- — CID 171638163
2-[2-[[4-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)benzimidazol-1-yl]methyl]phenoxy]-N-methyliodanuidylacetamide (PubChem CID 171638163) has the molecular formula C22H23IN5O3- and a molecular weight of 532.36 g/mol. Its IUPAC name is 2-[2-[[4-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)benzimidazol-1-yl]methyl]phenoxy]-N-methyliodanuidylacetamide.
| Compound Name | 2-[2-[[4-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)benzimidazol-1-yl]methyl]phenoxy]-N-methyliodanuidylacetamide |
|---|---|
| PubChem CID | 171638163 |
| Molecular Formula | C22H23IN5O3- |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 2-[2-[[4-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)benzimidazol-1-yl]methyl]phenoxy]-N-methyliodanuidylacetamide |
| SMILES | C[I-]NC(=O)COc1ccccc1Cn1cnc2c(N)cc(-c3c(C)noc3C)cc21 |
| InChI | InChI=1S/C22H23IN5O3/c1-13-21(14(2)31-27-13)16-8-17(24)22-18(9-16)28(12-25-22)10-15-6-4-5-7-19(15)30-11-20(29)26-23-3/h4-9,12H,10-11,24H2,1-3H3,(H,26,29)/q-1 |
| InChIKey | XZDPYGYZISKPOT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|