C24H22F3N3O5S — CID 135204079
N-benzyl-N-(1-cyclopropyl-2,2,2-trifluoroethyl)-2-(1,1,2',5'-tetraoxospiro[2H-1-benzothiophene-3,4'-imidazolidine]-1'-yl)acetamide (PubChem CID 135204079) has the molecular formula C24H22F3N3O5S and a molecular weight of 521.52 g/mol. Its IUPAC name is N-benzyl-N-(1-cyclopropyl-2,2,2-trifluoroethyl)-2-(1,1,2',5'-tetraoxospiro[2H-1-benzothiophene-3,4'-imidazolidine]-1'-yl)acetamide.
| Compound Name | N-benzyl-N-(1-cyclopropyl-2,2,2-trifluoroethyl)-2-(1,1,2',5'-tetraoxospiro[2H-1-benzothiophene-3,4'-imidazolidine]-1'-yl)acetamide |
|---|---|
| PubChem CID | 135204079 |
| Molecular Formula | C24H22F3N3O5S |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | N-benzyl-N-(1-cyclopropyl-2,2,2-trifluoroethyl)-2-(1,1,2',5'-tetraoxospiro[2H-1-benzothiophene-3,4'-imidazolidine]-1'-yl)acetamide |
| SMILES | O=C1NC2(CS(=O)(=O)c3ccccc32)C(=O)N1CC(=O)N(Cc1ccccc1)C(C1CC1)C(F)(F)F |
| InChI | InChI=1S/C24H22F3N3O5S/c25-24(26,27)20(16-10-11-16)29(12-15-6-2-1-3-7-15)19(31)13-30-21(32)23(28-22(30)33)14-36(34,35)18-9-5-4-8-17(18)23/h1-9,16,20H,10-14H2,(H,28,33) |
| InChIKey | PGXUSYSKJQTVMF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|