C22H13N3O3 — CID 135210329
3-[2-[5-(hydroxymethyl)-1H-indol-3-yl]-3,4-dioxocyclobuten-1-yl]-1H-indole-5-carbonitrile (PubChem CID 135210329) has the molecular formula C22H13N3O3 and a molecular weight of 367.36 g/mol. Its IUPAC name is 3-[2-[5-(hydroxymethyl)-1H-indol-3-yl]-3,4-dioxocyclobuten-1-yl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[2-[5-(hydroxymethyl)-1H-indol-3-yl]-3,4-dioxocyclobuten-1-yl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 135210329 |
| Molecular Formula | C22H13N3O3 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-[2-[5-(hydroxymethyl)-1H-indol-3-yl]-3,4-dioxocyclobuten-1-yl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(-c3c(-c4c[nH]c5ccc(CO)cc45)c(=O)c3=O)c2c1 |
| InChI | InChI=1S/C22H13N3O3/c23-7-11-1-3-17-13(5-11)15(8-24-17)19-20(22(28)21(19)27)16-9-25-18-4-2-12(10-26)6-14(16)18/h1-6,8-9,24-26H,10H2 |
| InChIKey | DHTPANSFJUYLBO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|