C44H42N6O2 — CID 135210846
4-[5-(4-amino-2,3-diethylphenyl)-1,3,4-oxadiazol-2-yl]-2,3-diethylaniline;2,5-dinaphthalen-1-yl-1,3,4-oxadiazole (PubChem CID 135210846) has the molecular formula C44H42N6O2 and a molecular weight of 686.86 g/mol. Its IUPAC name is 4-[5-(4-amino-2,3-diethylphenyl)-1,3,4-oxadiazol-2-yl]-2,3-diethylaniline;2,5-dinaphthalen-1-yl-1,3,4-oxadiazole.
| Compound Name | 4-[5-(4-amino-2,3-diethylphenyl)-1,3,4-oxadiazol-2-yl]-2,3-diethylaniline;2,5-dinaphthalen-1-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 135210846 |
| Molecular Formula | C44H42N6O2 |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.34 |
| IUPAC Name | 4-[5-(4-amino-2,3-diethylphenyl)-1,3,4-oxadiazol-2-yl]-2,3-diethylaniline;2,5-dinaphthalen-1-yl-1,3,4-oxadiazole |
| SMILES | CCc1c(N)ccc(-c2nnc(-c3ccc(N)c(CC)c3CC)o2)c1CC.c1ccc2c(-c3nnc(-c4cccc5ccccc45)o3)cccc2c1 |
| InChI | InChI=1S/C22H28N4O.C22H14N2O/c1-5-13-15(7-3)19(23)11-9-17(13)21-25-26-22(27-21)18-10-12-20(24)16(8-4)14(18)6-2;1-3-11-17-15(7-1)9-5-13-19(17)21-23-24-22(25-21)20-14-6-10-16-8-2-4-12-18(16)20/h9-12H,5-8,23-24H2,1-4H3;1-14H |
| InChIKey | YHGWHTPGSHMBSB-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|