C21H28N8O3 — CID 135212295
N-hydrazinylidene-N'-[6-[[methyl-[(3S)-3-methyl-1-oxo-2-(5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-8-yl]amino]methyl]pyridazin-3-yl]methanimidamide (PubChem CID 135212295) has the molecular formula C21H28N8O3 and a molecular weight of 440.51 g/mol. Its IUPAC name is N-hydrazinylidene-N'-[6-[[methyl-[(3S)-3-methyl-1-oxo-2-(5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-8-yl]amino]methyl]pyridazin-3-yl]methanimidamide.
| Compound Name | N-hydrazinylidene-N'-[6-[[methyl-[(3S)-3-methyl-1-oxo-2-(5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-8-yl]amino]methyl]pyridazin-3-yl]methanimidamide |
|---|---|
| PubChem CID | 135212295 |
| Molecular Formula | C21H28N8O3 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-hydrazinylidene-N'-[6-[[methyl-[(3S)-3-methyl-1-oxo-2-(5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-8-yl]amino]methyl]pyridazin-3-yl]methanimidamide |
| SMILES | C[C@H]1CC2(CCC(N(C)Cc3ccc(/N=C/N=N/N)nn3)CC2)C(=O)N1C1=CC(=O)OC1 |
| InChI | InChI=1S/C21H28N8O3/c1-14-10-21(20(31)29(14)17-9-19(30)32-12-17)7-5-16(6-8-21)28(2)11-15-3-4-18(26-25-15)23-13-24-27-22/h3-4,9,13-14,16H,5-8,10-12H2,1-2H3,(H2,22,23,24,26)/t14-,16?,21?/m0/s1 |
| InChIKey | XCEGCCHXSCNLQU-DOOHWEDMSA-N |
| XLogP | 1.88 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|