C20H26N8O3 — CID 135212075
N-hydrazinylidene-N'-[6-[[[2-(4-methyl-5-oxo-2H-furan-3-yl)-1-oxo-2-azaspiro[4.5]decan-8-yl]amino]methyl]pyridazin-3-yl]methanimidamide (PubChem CID 135212075) has the molecular formula C20H26N8O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-hydrazinylidene-N'-[6-[[[2-(4-methyl-5-oxo-2H-furan-3-yl)-1-oxo-2-azaspiro[4.5]decan-8-yl]amino]methyl]pyridazin-3-yl]methanimidamide.
| Compound Name | N-hydrazinylidene-N'-[6-[[[2-(4-methyl-5-oxo-2H-furan-3-yl)-1-oxo-2-azaspiro[4.5]decan-8-yl]amino]methyl]pyridazin-3-yl]methanimidamide |
|---|---|
| PubChem CID | 135212075 |
| Molecular Formula | C20H26N8O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-hydrazinylidene-N'-[6-[[[2-(4-methyl-5-oxo-2H-furan-3-yl)-1-oxo-2-azaspiro[4.5]decan-8-yl]amino]methyl]pyridazin-3-yl]methanimidamide |
| SMILES | CC1=C(N2CCC3(CCC(NCc4ccc(/N=C/N=N/N)nn4)CC3)C2=O)COC1=O |
| InChI | InChI=1S/C20H26N8O3/c1-13-16(11-31-18(13)29)28-9-8-20(19(28)30)6-4-14(5-7-20)22-10-15-2-3-17(26-25-15)23-12-24-27-21/h2-3,12,14,22H,4-11H2,1H3,(H2,21,23,24,26) |
| InChIKey | DRHVHNKNNKHXKJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 147.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|