C21H27IN6O3 — CID 144882894
8-[[6-[(diazenyl-λ3-iodanylidene)methylamino]-3-pyridinyl]methylamino]-2-(4-methyl-5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one (PubChem CID 144882894) has the molecular formula C21H27IN6O3 and a molecular weight of 538.39 g/mol. Its IUPAC name is 8-[[6-[(diazenyl-λ3-iodanylidene)methylamino]-3-pyridinyl]methylamino]-2-(4-methyl-5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one.
| Compound Name | 8-[[6-[(diazenyl-λ3-iodanylidene)methylamino]-3-pyridinyl]methylamino]-2-(4-methyl-5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 144882894 |
| Molecular Formula | C21H27IN6O3 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 8-[[6-[(diazenyl-λ3-iodanylidene)methylamino]-3-pyridinyl]methylamino]-2-(4-methyl-5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one |
| SMILES | [H]/N=N/I=C/Nc1ccc(CNC2CCC3(CC2)CCN(C2=C(C)C(=O)OC2)C3=O)cn1 |
| InChI | InChI=1S/C21H27IN6O3/c1-14-17(12-31-19(14)29)28-9-8-21(20(28)30)6-4-16(5-7-21)24-10-15-2-3-18(25-11-15)26-13-22-27-23/h2-3,11,13,16,23-24H,4-10,12H2,1H3,(H,25,26)/b27-23+ |
| InChIKey | RMJHBTOMGGEFIS-SLEBQGDGSA-N |
| XLogP | 3.25 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|