C20H26FN3O3 — CID 135214235
1-[2-(4-fluoro-2-methoxyphenyl)ethyl]-3-[3-(4-hydroxyphenyl)-2-(methylamino)propyl]urea (PubChem CID 135214235) has the molecular formula C20H26FN3O3 and a molecular weight of 375.44 g/mol. Its IUPAC name is 1-[2-(4-fluoro-2-methoxyphenyl)ethyl]-3-[3-(4-hydroxyphenyl)-2-(methylamino)propyl]urea.
| Compound Name | 1-[2-(4-fluoro-2-methoxyphenyl)ethyl]-3-[3-(4-hydroxyphenyl)-2-(methylamino)propyl]urea |
|---|---|
| PubChem CID | 135214235 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-[2-(4-fluoro-2-methoxyphenyl)ethyl]-3-[3-(4-hydroxyphenyl)-2-(methylamino)propyl]urea |
| SMILES | CNC(CNC(=O)NCCc1ccc(F)cc1OC)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C20H26FN3O3/c1-22-17(11-14-3-7-18(25)8-4-14)13-24-20(26)23-10-9-15-5-6-16(21)12-19(15)27-2/h3-8,12,17,22,25H,9-11,13H2,1-2H3,(H2,23,24,26) |
| InChIKey | BZVPOWZNYPCPTC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |