C26H23FN2O5 — CID 1352143
ethyl 4-[[3-(4-fluorophenyl)-2-[(2-methoxybenzoyl)amino]prop-2-enoyl]amino]benzoate (PubChem CID 1352143) has the molecular formula C26H23FN2O5 and a molecular weight of 462.48 g/mol. Its IUPAC name is ethyl 4-[[3-(4-fluorophenyl)-2-[(2-methoxybenzoyl)amino]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-(4-fluorophenyl)-2-[(2-methoxybenzoyl)amino]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 1352143 |
| Molecular Formula | C26H23FN2O5 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | ethyl 4-[[3-(4-fluorophenyl)-2-[(2-methoxybenzoyl)amino]prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=Cc2ccc(F)cc2)NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C26H23FN2O5/c1-3-34-26(32)18-10-14-20(15-11-18)28-25(31)22(16-17-8-12-19(27)13-9-17)29-24(30)21-6-4-5-7-23(21)33-2/h4-16H,3H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | MPLHOSZXOXKLRF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|