C26H17IN2 — CID 135215553
4-(3-iodophenyl)-2-naphthalen-1-yl-6-phenylpyrimidine (PubChem CID 135215553) has the molecular formula C26H17IN2 and a molecular weight of 484.34 g/mol. Its IUPAC name is 4-(3-iodophenyl)-2-naphthalen-1-yl-6-phenylpyrimidine.
| Compound Name | 4-(3-iodophenyl)-2-naphthalen-1-yl-6-phenylpyrimidine |
|---|---|
| PubChem CID | 135215553 |
| Molecular Formula | C26H17IN2 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 4-(3-iodophenyl)-2-naphthalen-1-yl-6-phenylpyrimidine |
| SMILES | Ic1cccc(-c2cc(-c3ccccc3)nc(-c3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C26H17IN2/c27-21-13-6-12-20(16-21)25-17-24(19-9-2-1-3-10-19)28-26(29-25)23-15-7-11-18-8-4-5-14-22(18)23/h1-17H |
| InChIKey | QBTCAMYNFCMFPW-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|