C31H33ClF2N2O4 — CID 135216622
ethyl 2-[2-chloro-4-(4,4-dimethylpiperidin-1-yl)-5-[3-fluoro-4-[2-(4-fluorophenyl)ethoxy]phenyl]-6-formyl-3-pyridinyl]acetate (PubChem CID 135216622) has the molecular formula C31H33ClF2N2O4 and a molecular weight of 571.06 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-(4,4-dimethylpiperidin-1-yl)-5-[3-fluoro-4-[2-(4-fluorophenyl)ethoxy]phenyl]-6-formyl-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-chloro-4-(4,4-dimethylpiperidin-1-yl)-5-[3-fluoro-4-[2-(4-fluorophenyl)ethoxy]phenyl]-6-formyl-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 135216622 |
| Molecular Formula | C31H33ClF2N2O4 |
| Molecular Weight | 571.06 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | ethyl 2-[2-chloro-4-(4,4-dimethylpiperidin-1-yl)-5-[3-fluoro-4-[2-(4-fluorophenyl)ethoxy]phenyl]-6-formyl-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(Cl)nc(C=O)c(-c2ccc(OCCc3ccc(F)cc3)c(F)c2)c1N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C31H33ClF2N2O4/c1-4-39-27(38)18-23-29(36-14-12-31(2,3)13-15-36)28(25(19-37)35-30(23)32)21-7-10-26(24(34)17-21)40-16-11-20-5-8-22(33)9-6-20/h5-10,17,19H,4,11-16,18H2,1-3H3 |
| InChIKey | NCDINJOJULVECK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.06 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|