C16H24N4O2S — CID 135216894
N-[4-[4-(sulfanylcarbamoyl)piperidin-1-yl]butan-2-yl]pyridine-2-carboxamide (PubChem CID 135216894) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[4-[4-(sulfanylcarbamoyl)piperidin-1-yl]butan-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[4-[4-(sulfanylcarbamoyl)piperidin-1-yl]butan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135216894 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[4-[4-(sulfanylcarbamoyl)piperidin-1-yl]butan-2-yl]pyridine-2-carboxamide |
| SMILES | CC(CCN1CCC(C(=O)NS)CC1)NC(=O)c1ccccn1 |
| InChI | InChI=1S/C16H24N4O2S/c1-12(18-16(22)14-4-2-3-8-17-14)5-9-20-10-6-13(7-11-20)15(21)19-23/h2-4,8,12-13,23H,5-7,9-11H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | AICZGTNSUHYYLF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|