C22H27ClN4O — CID 155674233
N-[(E)-[1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-2-methylpropylidene]amino]pyridine-2-carboxamide (PubChem CID 155674233) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is N-[(E)-[1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-2-methylpropylidene]amino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-[1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-2-methylpropylidene]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155674233 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[(E)-[1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-2-methylpropylidene]amino]pyridine-2-carboxamide |
| SMILES | CC(C)/C(=N\NC(=O)c1ccccn1)C1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H27ClN4O/c1-16(2)21(25-26-22(28)20-9-5-6-12-24-20)17-10-13-27(14-11-17)15-18-7-3-4-8-19(18)23/h3-9,12,16-17H,10-11,13-15H2,1-2H3,(H,26,28)/b25-21+ |
| InChIKey | IONUKEAJTBUPMP-NJNXFGOHSA-N |
| XLogP | 4.39 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|