C24H31ClN6O — CID 175107428
N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methylideneamino]-5-(4-methylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 175107428) has the molecular formula C24H31ClN6O and a molecular weight of 455.01 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methylideneamino]-5-(4-methylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methylideneamino]-5-(4-methylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175107428 |
| Molecular Formula | C24H31ClN6O |
| Molecular Weight | 455.01 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methylideneamino]-5-(4-methylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(C(=O)NN=CC3CCN(Cc4ccccc4Cl)CC3)nc2)CC1 |
| InChI | InChI=1S/C24H31ClN6O/c1-29-12-14-31(15-13-29)21-6-7-23(26-17-21)24(32)28-27-16-19-8-10-30(11-9-19)18-20-4-2-3-5-22(20)25/h2-7,16-17,19H,8-15,18H2,1H3,(H,28,32) |
| InChIKey | SZKHMHNCCOFOMZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.01 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|