C25H24ClF2N5O — CID 175113658
N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methylideneamino]-5-(3,4-difluoroanilino)pyridine-2-carboxamide (PubChem CID 175113658) has the molecular formula C25H24ClF2N5O and a molecular weight of 483.95 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methylideneamino]-5-(3,4-difluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methylideneamino]-5-(3,4-difluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175113658 |
| Molecular Formula | C25H24ClF2N5O |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]piperidin-4-yl]methylideneamino]-5-(3,4-difluoroanilino)pyridine-2-carboxamide |
| SMILES | O=C(NN=CC1CCN(Cc2ccccc2Cl)CC1)c1ccc(Nc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C25H24ClF2N5O/c26-21-4-2-1-3-18(21)16-33-11-9-17(10-12-33)14-30-32-25(34)24-8-6-20(15-29-24)31-19-5-7-22(27)23(28)13-19/h1-8,13-15,17,31H,9-12,16H2,(H,32,34) |
| InChIKey | SWVZKBXUEAAZOO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|