C23H29ClN4O — CID 155674267
N-[(E)-1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]pentylideneamino]pyridine-2-carboxamide (PubChem CID 155674267) has the molecular formula C23H29ClN4O and a molecular weight of 412.97 g/mol. Its IUPAC name is N-[(E)-1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]pentylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]pentylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155674267 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[(E)-1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]pentylideneamino]pyridine-2-carboxamide |
| SMILES | CCCC/C(=N\NC(=O)c1ccccn1)C1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H29ClN4O/c1-2-3-10-21(26-27-23(29)22-11-6-7-14-25-22)18-12-15-28(16-13-18)17-19-8-4-5-9-20(19)24/h4-9,11,14,18H,2-3,10,12-13,15-17H2,1H3,(H,27,29)/b26-21+ |
| InChIKey | FLHGIWXOLJFZQH-YYADALCUSA-N |
| XLogP | 4.92 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|