C26H29N5O2S — CID 135217481
1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]-N-phenylsulfanylpyrrolidin-3-amine (PubChem CID 135217481) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]-N-phenylsulfanylpyrrolidin-3-amine.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]-N-phenylsulfanylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 135217481 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]-N-phenylsulfanylpyrrolidin-3-amine |
| SMILES | COc1ccc(-c2c(C)nc3c(N4CCC(NSc5ccccc5)C4)cc(C)nn23)cc1OC |
| InChI | InChI=1S/C26H29N5O2S/c1-17-14-22(30-13-12-20(16-30)29-34-21-8-6-5-7-9-21)26-27-18(2)25(31(26)28-17)19-10-11-23(32-3)24(15-19)33-4/h5-11,14-15,20,29H,12-13,16H2,1-4H3 |
| InChIKey | MXLCVIIHWPULHC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|