C14H25N — CID 135219142
1-buta-1,3-dien-2-yl-3-pentylpiperidine (PubChem CID 135219142) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-3-pentylpiperidine.
| Compound Name | 1-buta-1,3-dien-2-yl-3-pentylpiperidine |
|---|---|
| PubChem CID | 135219142 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-3-pentylpiperidine |
| SMILES | C=CC(=C)N1CCCC(CCCCC)C1 |
| InChI | InChI=1S/C14H25N/c1-4-6-7-9-14-10-8-11-15(12-14)13(3)5-2/h5,14H,2-4,6-12H2,1H3 |
| InChIKey | QDRRMSZWHYYVNZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|