C12H25NO6P+ — CID 135221533
[4-[(Z)-but-2-enoyl]oxy-1-phosphonooxypentan-2-yl]-trimethylazanium (PubChem CID 135221533) has the molecular formula C12H25NO6P+ and a molecular weight of 310.31 g/mol. Its IUPAC name is [4-[(Z)-but-2-enoyl]oxy-1-phosphonooxypentan-2-yl]-trimethylazanium.
| Compound Name | [4-[(Z)-but-2-enoyl]oxy-1-phosphonooxypentan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 135221533 |
| Molecular Formula | C12H25NO6P+ |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [4-[(Z)-but-2-enoyl]oxy-1-phosphonooxypentan-2-yl]-trimethylazanium |
| SMILES | C/C=C\C(=O)OC(C)CC(COP(=O)(O)O)[N+](C)(C)C |
| InChI | InChI=1S/C12H24NO6P/c1-6-7-12(14)19-10(2)8-11(13(3,4)5)9-18-20(15,16)17/h6-7,10-11H,8-9H2,1-5H3,(H-,15,16,17)/p+1/b7-6- |
| InChIKey | MGZHBRCWZYGNRZ-SREVYHEPSA-O |
| XLogP | 1.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|