C16H35NO7P+ — CID 175531335
(4-hydroxy-5-octanoyloxy-1-phosphonooxypentan-2-yl)-trimethylazanium (PubChem CID 175531335) has the molecular formula C16H35NO7P+ and a molecular weight of 384.43 g/mol. Its IUPAC name is (4-hydroxy-5-octanoyloxy-1-phosphonooxypentan-2-yl)-trimethylazanium.
| Compound Name | (4-hydroxy-5-octanoyloxy-1-phosphonooxypentan-2-yl)-trimethylazanium |
|---|---|
| PubChem CID | 175531335 |
| Molecular Formula | C16H35NO7P+ |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (4-hydroxy-5-octanoyloxy-1-phosphonooxypentan-2-yl)-trimethylazanium |
| SMILES | CCCCCCCC(=O)OCC(O)CC(COP(=O)(O)O)[N+](C)(C)C |
| InChI | InChI=1S/C16H34NO7P/c1-5-6-7-8-9-10-16(19)23-13-15(18)11-14(17(2,3)4)12-24-25(20,21)22/h14-15,18H,5-13H2,1-4H3,(H-,20,21,22)/p+1 |
| InChIKey | KTFSKXAKTHNNGU-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|