C13H16F2O2 — CID 135222385
6-[(2,6-difluorophenyl)methoxy]hexan-2-one (PubChem CID 135222385) has the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. Its IUPAC name is 6-[(2,6-difluorophenyl)methoxy]hexan-2-one.
| Compound Name | 6-[(2,6-difluorophenyl)methoxy]hexan-2-one |
|---|---|
| PubChem CID | 135222385 |
| Molecular Formula | C13H16F2O2 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 6-[(2,6-difluorophenyl)methoxy]hexan-2-one |
| SMILES | CC(=O)CCCCOCc1c(F)cccc1F |
| InChI | InChI=1S/C13H16F2O2/c1-10(16)5-2-3-8-17-9-11-12(14)6-4-7-13(11)15/h4,6-7H,2-3,5,8-9H2,1H3 |
| InChIKey | DAHQXEWOCWLWNH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|