C23H19FN4O3S — CID 135223157
1-[4-[2-(3-fluorophenyl)phenyl]sulfonylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea (PubChem CID 135223157) has the molecular formula C23H19FN4O3S and a molecular weight of 450.50 g/mol. Its IUPAC name is 1-[4-[2-(3-fluorophenyl)phenyl]sulfonylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea.
| Compound Name | 1-[4-[2-(3-fluorophenyl)phenyl]sulfonylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135223157 |
| Molecular Formula | C23H19FN4O3S |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 1-[4-[2-(3-fluorophenyl)phenyl]sulfonylphenyl]-3-(1H-pyrazol-4-ylmethyl)urea |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)F)S(=O)(=O)C3=CC=C(C=C3)NC(=O)NCC4=CNN=C4 |
| InChI | InChI=1S/C23H19FN4O3S/c24-18-5-3-4-17(12-18)21-6-1-2-7-22(21)32(30,31)20-10-8-19(9-11-20)28-23(29)25-13-16-14-26-27-15-16/h1-12,14-15H,13H2,(H,26,27)(H2,25,28,29) |
| InChIKey | BNBDADCSLLKESV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | 723 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |