C24H27N3O4 — CID 135223658
benzyl N,N-bis[2-(4-aminophenoxy)ethyl]carbamate (PubChem CID 135223658) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is benzyl N,N-bis[2-(4-aminophenoxy)ethyl]carbamate.
| Compound Name | benzyl N,N-bis[2-(4-aminophenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 135223658 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | benzyl N,N-bis[2-(4-aminophenoxy)ethyl]carbamate |
| SMILES | Nc1ccc(OCCN(CCOc2ccc(N)cc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N3O4/c25-20-6-10-22(11-7-20)29-16-14-27(15-17-30-23-12-8-21(26)9-13-23)24(28)31-18-19-4-2-1-3-5-19/h1-13H,14-18,25-26H2 |
| InChIKey | RKYZKYWJIAIBJC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|