C12H13N — CID 135225317
(4Z,5Z)-4,5-bis(prop-2-enylidene)-3H-azepine (PubChem CID 135225317) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is (4Z,5Z)-4,5-bis(prop-2-enylidene)-3H-azepine.
| Compound Name | (4Z,5Z)-4,5-bis(prop-2-enylidene)-3H-azepine |
|---|---|
| PubChem CID | 135225317 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (4Z,5Z)-4,5-bis(prop-2-enylidene)-3H-azepine |
| SMILES | C=C/C=C1/C=CN=CC/C1=C/C=C |
| InChI | InChI=1S/C12H13N/c1-3-5-11-7-9-13-10-8-12(11)6-4-2/h3-7,9-10H,1-2,8H2/b11-5-,12-6- |
| InChIKey | MIBRHELQWFTUOR-CBIKUMSCSA-N |
| XLogP | 3.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |