C16H29NO2 — CID 135225364
1-[(5E,7E)-6,7-dimethoxy-4-methylnona-5,7-dienyl]pyrrolidine (PubChem CID 135225364) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 1-[(5E,7E)-6,7-dimethoxy-4-methylnona-5,7-dienyl]pyrrolidine.
| Compound Name | 1-[(5E,7E)-6,7-dimethoxy-4-methylnona-5,7-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 135225364 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 1-[(5E,7E)-6,7-dimethoxy-4-methylnona-5,7-dienyl]pyrrolidine |
| SMILES | C/C=C(OC)\C(=C/C(C)CCCN1CCCC1)OC |
| InChI | InChI=1S/C16H29NO2/c1-5-15(18-3)16(19-4)13-14(2)9-8-12-17-10-6-7-11-17/h5,13-14H,6-12H2,1-4H3/b15-5+,16-13+ |
| InChIKey | ODBWTMBWZZUSSA-LIXVMJQCSA-N |
| XLogP | 3.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|