C34H41F2N5O5 — CID 135226238
tert-butyl 4-[5-[[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 135226238) has the molecular formula C34H41F2N5O5 and a molecular weight of 637.73 g/mol. Its IUPAC name is tert-butyl 4-[5-[[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 135226238 |
| Molecular Formula | C34H41F2N5O5 |
| Molecular Weight | 637.73 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | tert-butyl 4-[5-[[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COCC[C@@H]1C[C@@H](NC(=O)Nc2c(C)c(C3=CCN(C(=O)OC(C)(C)C)CC3)nn2-c2ccccc2)[C@H](c2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C34H41F2N5O5/c1-21-29(22-13-16-40(17-14-22)33(43)46-34(2,3)4)39-41(24-9-7-6-8-10-24)31(21)38-32(42)37-28-20-25(15-18-44-5)45-30(28)23-11-12-26(35)27(36)19-23/h6-13,19,25,28,30H,14-18,20H2,1-5H3,(H2,37,38,42)/t25-,28-,30+/m1/s1 |
| InChIKey | YBIFZJSUVHNSON-CZMKHNCBSA-N |
| XLogP | 6.54 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |