C31H35F2N5O5 — CID 135226241
1-[(2R,3S,5R)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]-3-[3-[1-(2-hydroxyacetyl)-3,6-dihydro-2H-pyridin-4-yl]-4-methyl-1-phenylpyrazol-5-yl]urea (PubChem CID 135226241) has the molecular formula C31H35F2N5O5 and a molecular weight of 595.65 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]-3-[3-[1-(2-hydroxyacetyl)-3,6-dihydro-2H-pyridin-4-yl]-4-methyl-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[(2R,3S,5R)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]-3-[3-[1-(2-hydroxyacetyl)-3,6-dihydro-2H-pyridin-4-yl]-4-methyl-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 135226241 |
| Molecular Formula | C31H35F2N5O5 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 1-[(2R,3S,5R)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]-3-[3-[1-(2-hydroxyacetyl)-3,6-dihydro-2H-pyridin-4-yl]-4-methyl-1-phenylpyrazol-5-yl]urea |
| SMILES | COCC[C@H]1C[C@H](NC(=O)Nc2c(C)c(C3=CCN(C(=O)CO)CC3)nn2-c2ccccc2)[C@@H](c2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C31H35F2N5O5/c1-19-28(20-10-13-37(14-11-20)27(40)18-39)36-38(22-6-4-3-5-7-22)30(19)35-31(41)34-26-17-23(12-15-42-2)43-29(26)21-8-9-24(32)25(33)16-21/h3-10,16,23,26,29,39H,11-15,17-18H2,1-2H3,(H2,34,35,41)/t23-,26-,29+/m0/s1 |
| InChIKey | AWCRYTFFTONRRU-RSRUXJMGSA-N |
| XLogP | 4.12 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |