C10H10FNO — CID 135228270
4-(4-fluorophenyl)-2-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 135228270) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(4-fluorophenyl)-2-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135228270 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-(4-fluorophenyl)-2-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC1=NC(c2ccc(F)cc2)CO1 |
| InChI | InChI=1S/C10H10FNO/c1-7-12-10(6-13-7)8-2-4-9(11)5-3-8/h2-5,10H,6H2,1H3 |
| InChIKey | GZUXCZKPZCDLBF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |