C15H12ClN7S — CID 135230272
4-chloro-1-(1-methyltetrazol-5-yl)-2-(pyridin-2-ylmethylsulfanyl)benzimidazole (PubChem CID 135230272) has the molecular formula C15H12ClN7S and a molecular weight of 357.83 g/mol. Its IUPAC name is 4-chloro-1-(1-methyltetrazol-5-yl)-2-(pyridin-2-ylmethylsulfanyl)benzimidazole.
| Compound Name | 4-chloro-1-(1-methyltetrazol-5-yl)-2-(pyridin-2-ylmethylsulfanyl)benzimidazole |
|---|---|
| PubChem CID | 135230272 |
| Molecular Formula | C15H12ClN7S |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-chloro-1-(1-methyltetrazol-5-yl)-2-(pyridin-2-ylmethylsulfanyl)benzimidazole |
| SMILES | Cn1nnnc1-n1c(SCc2ccccn2)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C15H12ClN7S/c1-22-14(19-20-21-22)23-12-7-4-6-11(16)13(12)18-15(23)24-9-10-5-2-3-8-17-10/h2-8H,9H2,1H3 |
| InChIKey | FILCKVWPNHZKEV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |