C14H12N8S — CID 135230197
1-(1-methyltetrazol-5-yl)-2-(pyrimidin-4-ylmethylsulfanyl)benzimidazole (PubChem CID 135230197) has the molecular formula C14H12N8S and a molecular weight of 324.37 g/mol. Its IUPAC name is 1-(1-methyltetrazol-5-yl)-2-(pyrimidin-4-ylmethylsulfanyl)benzimidazole.
| Compound Name | 1-(1-methyltetrazol-5-yl)-2-(pyrimidin-4-ylmethylsulfanyl)benzimidazole |
|---|---|
| PubChem CID | 135230197 |
| Molecular Formula | C14H12N8S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-(1-methyltetrazol-5-yl)-2-(pyrimidin-4-ylmethylsulfanyl)benzimidazole |
| SMILES | Cn1nnnc1-n1c(SCc2ccncn2)nc2ccccc21 |
| InChI | InChI=1S/C14H12N8S/c1-21-13(18-19-20-21)22-12-5-3-2-4-11(12)17-14(22)23-8-10-6-7-15-9-16-10/h2-7,9H,8H2,1H3 |
| InChIKey | DEPMNCYFASMBKE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |