C11H11N7S — CID 63637570
2-[1-(1-methyltetrazol-5-yl)benzimidazol-2-yl]ethanethioamide (PubChem CID 63637570) has the molecular formula C11H11N7S and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[1-(1-methyltetrazol-5-yl)benzimidazol-2-yl]ethanethioamide.
| Compound Name | 2-[1-(1-methyltetrazol-5-yl)benzimidazol-2-yl]ethanethioamide |
|---|---|
| PubChem CID | 63637570 |
| Molecular Formula | C11H11N7S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[1-(1-methyltetrazol-5-yl)benzimidazol-2-yl]ethanethioamide |
| SMILES | Cn1nnnc1-n1c(CC(N)=S)nc2ccccc21 |
| InChI | InChI=1S/C11H11N7S/c1-17-11(14-15-16-17)18-8-5-3-2-4-7(8)13-10(18)6-9(12)19/h2-5H,6H2,1H3,(H2,12,19) |
| InChIKey | IPQTWOBZTBYLGY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|