C18H14N4O2S — CID 135231204
1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-oxazol-5-ylmethyl)urea (PubChem CID 135231204) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-oxazol-5-ylmethyl)urea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-oxazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 135231204 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(1,3-oxazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1cnco1)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H14N4O2S/c23-18(20-10-14-9-19-11-24-14)21-13-7-5-12(6-8-13)17-22-15-3-1-2-4-16(15)25-17/h1-9,11H,10H2,(H2,20,21,23) |
| InChIKey | XZJWHOGECLOBFE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |